Difference between revisions of "SJ20250"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * common-name: ** ent-kaurene * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] == * common-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] ==
 
* common-name:
 
* common-name:
** ent-kaurene
+
** vitamin k 2,3-epoxide
 
* smiles:
 
* smiles:
** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c)cccc(c)2[ch]3cc4))))
+
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
 
* inchi-key:
 
* inchi-key:
** onvabdhfqkwosv-hpusydddsa-n
+
** kutxfbihpwidjq-hbdfacptsa-n
 
* molecular-weight:
 
* molecular-weight:
** 272.473
+
** 466.703
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.13.78-RXN]]
+
* [[1.1.4.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.4.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ent-kaurene}}
+
{{#set: common-name=vitamin k 2,3-epoxide}}
{{#set: inchi-key=inchikey=onvabdhfqkwosv-hpusydddsa-n}}
+
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
{{#set: molecular-weight=272.473}}
+
{{#set: molecular-weight=466.703}}

Revision as of 14:20, 26 August 2019

Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ

  • common-name:
    • vitamin k 2,3-epoxide
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
  • inchi-key:
    • kutxfbihpwidjq-hbdfacptsa-n
  • molecular-weight:
    • 466.703

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality