Difference between revisions of "SJ20332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * common-name: ** pyridoxamine * smiles: ** cc1(=nc=c(co)c(c[n+])...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] == * common-name: ** 3-demethylubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] ==
 
* common-name:
 
* common-name:
** pyridoxamine
+
** 3-demethylubiquinol-7
 
* smiles:
 
* smiles:
** cc1(=nc=c(co)c(c[n+])=c(o)1)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
* inchi-key:
** nhzmqxzhnvqtqa-uhfffaoysa-o
+
** ohbhbmxnjcumcr-dkccahehsa-n
 
* molecular-weight:
 
* molecular-weight:
** 169.203
+
** 646.992
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRAMKIN-RXN]]
+
* [[RXN-9229]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYAMPP]]
 
* [[RXN-14046]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxamine}}
+
{{#set: common-name=3-demethylubiquinol-7}}
{{#set: inchi-key=inchikey=nhzmqxzhnvqtqa-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ohbhbmxnjcumcr-dkccahehsa-n}}
{{#set: molecular-weight=169.203}}
+
{{#set: molecular-weight=646.992}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-9861

  • common-name:
    • 3-demethylubiquinol-7
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
  • inchi-key:
    • ohbhbmxnjcumcr-dkccahehsa-n
  • molecular-weight:
    • 646.992

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality