Difference between revisions of "SJ20356"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUMO-propeptides SUMO-propeptides] == * common-name: ** a small ubiquitin-like modifier (sumo)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUMO-propeptides SUMO-propeptides] ==
 
* common-name:
 
* common-name:
** phenylacetylglycine
+
** a small ubiquitin-like modifier (sumo) propeptide
* smiles:
 
** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1)
 
* inchi-key:
 
** utyvdvlmyqplqb-uhfffaoysa-m
 
* molecular-weight:
 
** 192.194
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.22.68-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10821]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetylglycine}}
+
{{#set: common-name=a small ubiquitin-like modifier (sumo) propeptide}}
{{#set: inchi-key=inchikey=utyvdvlmyqplqb-uhfffaoysa-m}}
 
{{#set: molecular-weight=192.194}}
 

Revision as of 14:20, 26 August 2019

Metabolite SUMO-propeptides

  • common-name:
    • a small ubiquitin-like modifier (sumo) propeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality