Difference between revisions of "SJ20427"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19759 CPD-19759] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19759 CPD-19759] ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** β-d-ribose 5-phosphate
+
** 71-dihydroxychlorophyllide a
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
 
* inchi-key:
 
** ktvpxoyakdprhy-txicztdvsa-l
 
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 644.965
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
+
* [[RXN-7677]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-ribose 5-phosphate}}
+
{{#set: common-name=71-dihydroxychlorophyllide a}}
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}}
+
{{#set: molecular-weight=644.965}}
{{#set: molecular-weight=228.095}}
 

Revision as of 09:24, 27 August 2019

Metabolite CPD-19759

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 71-dihydroxychlorophyllide a
  • molecular-weight:
    • 644.965

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality