Difference between revisions of "SJ20435"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7630 CPD-7630] == * common-name: ** (-)-epicatechin * smiles: ** c3(=c(c2(oc1(=cc(=cc(=c1cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * common-name: ** xxxg xyloglucan oligosaccharide * smiles: ** c1(c(c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7630 CPD-7630] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] ==
 
* common-name:
 
* common-name:
** (-)-epicatechin
+
** xxxg xyloglucan oligosaccharide
 
* smiles:
 
* smiles:
** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o)
+
** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
 
* inchi-key:
 
* inchi-key:
** pftawblqpzvemu-ukrrqhhqsa-n
+
** pzupagrihcrvkn-sphbqonksa-n
 
* molecular-weight:
 
* molecular-weight:
** 290.272
+
** 1062.931
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9725]]
+
* [[RXN-12398]]
 +
* [[RXN-12399]]
 +
* [[RXN-12400]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-epicatechin}}
+
{{#set: common-name=xxxg xyloglucan oligosaccharide}}
{{#set: inchi-key=inchikey=pftawblqpzvemu-ukrrqhhqsa-n}}
+
{{#set: inchi-key=inchikey=pzupagrihcrvkn-sphbqonksa-n}}
{{#set: molecular-weight=290.272}}
+
{{#set: molecular-weight=1062.931}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13375

  • common-name:
    • xxxg xyloglucan oligosaccharide
  • smiles:
    • c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
  • inchi-key:
    • pzupagrihcrvkn-sphbqonksa-n
  • molecular-weight:
    • 1062.931

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality