Difference between revisions of "SJ20458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=...")
(Created page with "Category:gene == Gene SJ20458 == * transcription-direction: ** positive * right-end-position: ** 1048083 * left-end-position: ** 1013084 * centisome-position: ** 89.20246...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] ==
+
== Gene SJ20458 ==
−
* common-name:
+
* transcription-direction:
−
** sn-glycerol 3-phosphate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(op([o-])(=o)[o-])c(o)co
+
** 1048083
−
* inchi-key:
+
* left-end-position:
−
** awucvroldviajx-gsvougtgsa-l
+
** 1013084
−
* molecular-weight:
+
* centisome-position:
−
** 170.058
+
** 89.20246   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[G3PD2]]
+
== Reaction(s) associated ==
−
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[GLYCEROL-KIN-RXN]]
+
* [[3.6.3.44-RXN]]
−
* [[PHOSPHAGLYPSYN-RXN]]
+
** Category: [[annotation]]
−
* [[RXN-10462]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-13112]]
+
* [[ATPASE-RXN]]
−
* [[RXN-13805]]
+
** Category: [[annotation]]
−
* [[RXN-1381]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-14965]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
−
* [[RXN-15045]]
+
** Category: [[annotation]]
−
* [[RXN-15740]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-15745]]
+
* [[RXN-12195]]
−
* [[RXN-16024]]
+
** Category: [[annotation]]
−
* [[RXN-16117]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-17016]]
+
* [[RXN-12196]]
−
* [[RXN-17017]]
+
** Category: [[annotation]]
−
* [[RXN-17018]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN0-5260]]
+
* [[RXN0-5462]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[1.1.1.8-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[TRANS-RXN-311]]
−
* [[G3PD2]]
+
** Category: [[annotation]]
−
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLYCEROL-KIN-RXN]]
+
</div>
−
* [[GLYCPDIESTER-RXN]]
+
== Pathway(s) associated ==
−
* [[RXN-13112]]
+
* [[PWY-6545]]
−
* [[RXN-13805]]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-14073]]
+
* [[PWY-7210]]
−
* [[RXN-14136]]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN-14160]]
+
* [[PWY-7198]]
−
== Reaction(s) of unknown directionality ==
+
** '''6''' reactions found over '''7''' reactions in the full pathway
−
{{#set: common-name=sn-glycerol 3-phosphate}}
+
* [[PWY-7184]]
−
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
+
** '''9''' reactions found over '''9''' reactions in the full pathway
−
{{#set: molecular-weight=170.058}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=1048083}}
 +
{{#set: left-end-position=1013084}}
 +
{{#set: centisome-position=89.20246    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=7}}
 +
{{#set: nb pathway associated=4}}

Latest revision as of 11:03, 18 March 2021

Gene SJ20458

  • transcription-direction:
    • positive
  • right-end-position:
    • 1048083
  • left-end-position:
    • 1013084
  • centisome-position:
    • 89.20246

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ20458&oldid=132912"