Difference between revisions of "SJ20458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=...")
(Created page with "Category:gene == Gene SJ03581 == * transcription-direction: ** negative * right-end-position: ** 21965 * left-end-position: ** 16629 * centisome-position: ** 14.026756...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] ==
+
== Gene SJ03581 ==
* common-name:
+
* transcription-direction:
** sn-glycerol 3-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(op([o-])(=o)[o-])c(o)co
+
** 21965
* inchi-key:
+
* left-end-position:
** awucvroldviajx-gsvougtgsa-l
+
** 16629
* molecular-weight:
+
* centisome-position:
** 170.058
+
** 14.026756   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[G3PD2]]
+
== Reaction(s) associated ==
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
* [[GLYCEROL-KIN-RXN]]
+
** Category: [[annotation]]
* [[PHOSPHAGLYPSYN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-10462]]
+
* [[RXN-16165]]
* [[RXN-13112]]
+
** Category: [[annotation]]
* [[RXN-13805]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-1381]]
+
== Pathway(s) associated ==
* [[RXN-14965]]
+
* [[TRNA-CHARGING-PWY]]
* [[RXN-15045]]
+
** '''21''' reactions found over '''21''' reactions in the full pathway
* [[RXN-15740]]
+
{{#set: transcription-direction=negative}}
* [[RXN-15745]]
+
{{#set: right-end-position=21965}}
* [[RXN-16024]]
+
{{#set: left-end-position=16629}}
* [[RXN-16117]]
+
{{#set: centisome-position=14.026756    }}
* [[RXN-17016]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[RXN-17017]]
+
{{#set: nb reaction associated=2}}
* [[RXN-17018]]
+
{{#set: nb pathway associated=1}}
* [[RXN0-5260]]
 
== Reaction(s) known to produce the compound ==
 
* [[1.1.1.8-RXN]]
 
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 
* [[G3PD2]]
 
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 
* [[GLYCEROL-KIN-RXN]]
 
* [[GLYCPDIESTER-RXN]]
 
* [[RXN-13112]]
 
* [[RXN-13805]]
 
* [[RXN-14073]]
 
* [[RXN-14136]]
 
* [[RXN-14160]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=sn-glycerol 3-phosphate}}
 
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
 
{{#set: molecular-weight=170.058}}
 

Revision as of 20:21, 18 December 2020

Gene SJ03581

  • transcription-direction:
    • negative
  • right-end-position:
    • 21965
  • left-end-position:
    • 16629
  • centisome-position:
    • 14.026756

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated