Difference between revisions of "SJ20472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] == * common-name: ** s-methyl-5'-thioadenosine * s...")
(Created page with "Category:gene == Gene SJ20472 == * transcription-direction: ** negative * right-end-position: ** 35450 * left-end-position: ** 16255 * centisome-position: ** 2.630161...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] ==
+
== Gene SJ20472 ==
* common-name:
+
* transcription-direction:
** s-methyl-5'-thioadenosine
+
** negative
* smiles:
+
* right-end-position:
** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** 35450
* inchi-key:
+
* left-end-position:
** wuugfsxjnotrmr-ioslpcccsa-n
+
** 16255
* molecular-weight:
+
* centisome-position:
** 297.331
+
** 2.630161   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[M5TAP]]
+
* [[S.japonica_carotenoid_curated]]
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+
== Reaction(s) associated ==
* [[RXN-11190]]
+
* [[RXN-14554]]
* [[SPERMIDINESYN-RXN]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[4.4.1.14-RXN]]
+
{{#set: transcription-direction=negative}}
* [[APAPT]]
+
{{#set: right-end-position=35450}}
* [[RXN-11190]]
+
{{#set: left-end-position=16255}}
* [[RXN-11371]]
+
{{#set: centisome-position=2.630161    }}
* [[RXN-14518]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN0-5217]]
+
{{#set: nb reaction associated=1}}
* [[SPERMIDINESYN-RXN]]
 
* [[SPERMINE-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=s-methyl-5'-thioadenosine}}
 
{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
 
{{#set: molecular-weight=297.331}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ20472

  • transcription-direction:
    • negative
  • right-end-position:
    • 35450
  • left-end-position:
    • 16255
  • centisome-position:
    • 2.630161

Organism(s) associated with this gene

Reaction(s) associated