Difference between revisions of "SJ20472"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Guanines DNA-Guanines] == * common-name: ** a guanine in dna == Reaction(s) known to consum...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] == * common-name: ** s-methyl-5'-thioadenosine * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-methyl-5'-thioadenosine |
| + | * smiles: | ||
| + | ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) | ||
| + | * inchi-key: | ||
| + | ** wuugfsxjnotrmr-ioslpcccsa-n | ||
| + | * molecular-weight: | ||
| + | ** 297.331 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[M5TAP]] | ||
| + | * [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]] | ||
| + | * [[RXN-11190]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.4.1.14-RXN]] |
| + | * [[APAPT]] | ||
| + | * [[RXN-11190]] | ||
| + | * [[RXN-11371]] | ||
| + | * [[RXN-14518]] | ||
| + | * [[RXN0-5217]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
| + | * [[SPERMINE-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-methyl-5'-thioadenosine}} |
| + | {{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}} | ||
| + | {{#set: molecular-weight=297.331}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite 5-METHYLTHIOADENOSINE
- common-name:
- s-methyl-5'-thioadenosine
- smiles:
- cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- wuugfsxjnotrmr-ioslpcccsa-n
- molecular-weight:
- 297.331
