Difference between revisions of "SJ20510"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15836 CPD-15836] == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15836 CPD-15836] == |
* common-name: | * common-name: | ||
− | ** | + | ** α-tocotrienol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rzfhlolgzpdchj-xzxlulotsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 424.665 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14918]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-tocotrienol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rzfhlolgzpdchj-xzxlulotsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=424.665}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-15836
- common-name:
- α-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
- inchi-key:
- rzfhlolgzpdchj-xzxlulotsa-n
- molecular-weight:
- 424.665