Difference between revisions of "SJ20556"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: **...")
(Created page with "Category:gene == Gene SJ17981 == * transcription-direction: ** positive * right-end-position: ** 72750 * left-end-position: ** 48843 * centisome-position: ** 19.278332...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] ==
+
== Gene SJ17981 ==
* common-name:
+
* transcription-direction:
** β-d-fructofuranose 6-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
+
** 72750
* inchi-key:
+
* left-end-position:
** bgwgxpapygqalx-arqdhwqxsa-l
+
** 48843
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 19.278332   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.7.1.90-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[2TRANSKETO-RXN]]
+
== Reaction(s) associated ==
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
+
* [[R145-RXN]]
* [[6PFRUCTPHOS-RXN]]
+
** Category: [[annotation]]
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[MANNPDEHYDROG-RXN]]
+
* [[R147-RXN]]
* [[MANNPISOM-RXN]]
+
** Category: [[annotation]]
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[PFK_]]
+
== Pathway(s) associated ==
* [[PGIA]]
+
* [[PWY-4361]]
* [[PGIAh]]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
* [[PGIB]]
+
{{#set: transcription-direction=positive}}
* [[PGIBh]]
+
{{#set: right-end-position=72750}}
* [[PGLUCISOM-RXN]]
+
{{#set: left-end-position=48843}}
* [[RXN-14812]]
+
{{#set: centisome-position=19.278332    }}
* [[TRANSALDOL-RXN]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction associated=2}}
* [[2.7.1.90-RXN]]
+
{{#set: nb pathway associated=1}}
* [[2TRANSKETO-RXN]]
 
* [[3.1.3.46-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
* [[FRUCTOKINASE-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[MANNPDEHYDROG-RXN]]
 
* [[MANNPISOM-RXN]]
 
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[PGLUCISOM-RXN]]
 
* [[RXN-14812]]
 
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
 
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 20:20, 18 December 2020

Gene SJ17981

  • transcription-direction:
    • positive
  • right-end-position:
    • 72750
  • left-end-position:
    • 48843
  • centisome-position:
    • 19.278332

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-4361
    • 3 reactions found over 7 reactions in the full pathway