Difference between revisions of "SJ20573"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] == * common-name: ** pyridoxal 5'-phosphate * smiles:...")
 
(Created page with "Category:gene == Gene SJ20573 == * transcription-direction: ** negative * right-end-position: ** 25691 * left-end-position: ** 8346 * centisome-position: ** 4.056182 =...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] ==
+
== Gene SJ20573 ==
* common-name:
+
* transcription-direction:
** pyridoxal 5'-phosphate
+
** negative
* smiles:
+
* right-end-position:
** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-])
+
** 25691
* inchi-key:
+
* left-end-position:
** ngvdgcnfywlifo-uhfffaoysa-l
+
** 8346
* molecular-weight:
+
* centisome-position:
** 245.128
+
** 4.056182   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3.1.3.74-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[PMPOXI-RXN]]
+
* [[3.4.19.12-RXN]]
* [[PNPOXI-RXN]]
+
** Category: [[annotation]]
* [[PYRIDOXKIN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-11322]]
+
{{#set: transcription-direction=negative}}
* [[RXN-12590]]
+
{{#set: right-end-position=25691}}
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=8346}}
{{#set: common-name=pyridoxal 5'-phosphate}}
+
{{#set: centisome-position=4.056182    }}
{{#set: inchi-key=inchikey=ngvdgcnfywlifo-uhfffaoysa-l}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
{{#set: molecular-weight=245.128}}
+
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ20573

  • transcription-direction:
    • negative
  • right-end-position:
    • 25691
  • left-end-position:
    • 8346
  • centisome-position:
    • 4.056182

Organism(s) associated with this gene

Reaction(s) associated