Difference between revisions of "SJ20573"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * common-name: ** (3r)-3-hydroxy-...")
(Created page with "Category:gene == Gene SJ20573 == * transcription-direction: ** negative * right-end-position: ** 25691 * left-end-position: ** 8346 * centisome-position: ** 4.056182 =...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Gene SJ20573 ==
* common-name:
+
* transcription-direction:
** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
+
** negative
* smiles:
+
* right-end-position:
** c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
+
** 25691
* inchi-key:
+
* left-end-position:
** mzjfvxdtnbhtkz-uwtatzphsa-k
+
** 8346
* molecular-weight:
+
* centisome-position:
** 211.045
+
** 4.056182   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[PSERTRANSAMPYR-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[PSERTRANSAMPYR-RXN]]
+
* [[3.4.19.12-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=mzjfvxdtnbhtkz-uwtatzphsa-k}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=211.045}}
+
{{#set: right-end-position=25691}}
 +
{{#set: left-end-position=8346}}
 +
{{#set: centisome-position=4.056182    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ20573

  • transcription-direction:
    • negative
  • right-end-position:
    • 25691
  • left-end-position:
    • 8346
  • centisome-position:
    • 4.056182

Organism(s) associated with this gene

Reaction(s) associated