Difference between revisions of "SJ20612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl pho...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Ser-or-Thr-phosphate Protein-Ser-or-Thr-phosphate] == * common-name: ** a [protein] (l-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Ser-or-Thr-phosphate Protein-Ser-or-Thr-phosphate] ==
 
* common-name:
 
* common-name:
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
+
** a [protein] (l-serine/l-threonine) phosphate
* smiles:
 
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
 
* inchi-key:
 
** mbyvktiiznuhkn-nivaaieqsa-m
 
* molecular-weight:
 
** 1012.461
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.3.16-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16602]]
+
* [[PROTEIN-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)}}
+
{{#set: common-name=a [protein] (l-serine/l-threonine) phosphate}}
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
 
{{#set: molecular-weight=1012.461}}
 

Revision as of 09:25, 27 August 2019

Metabolite Protein-Ser-or-Thr-phosphate

  • common-name:
    • a [protein] (l-serine/l-threonine) phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] (l-serine/l-threonine) phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.