Difference between revisions of "SJ20634"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mercapturates Mercapturates] == * common-name: ** a mercapturate == Reaction(s) known to consum...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mercapturates Mercapturates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
 
* common-name:
 
* common-name:
** a mercapturate
+
** mycophenolic acid o-acyl-glucuronide
 +
* smiles:
 +
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
 +
* inchi-key:
 +
** qbmstezxamabff-uearnrkisa-m
 +
* molecular-weight:
 +
** 495.459
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13684]]
+
* [[RXN-13605]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13607]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a mercapturate}}
+
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
 +
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
 +
{{#set: molecular-weight=495.459}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-14602

  • common-name:
    • mycophenolic acid o-acyl-glucuronide
  • smiles:
    • cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
  • inchi-key:
    • qbmstezxamabff-uearnrkisa-m
  • molecular-weight:
    • 495.459

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality