Difference between revisions of "SJ20648"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-OXALOACETATE ENOL-OXALOACETATE] == * common-name: ** enol-oxaloacetate * smiles: ** c([o-]...")
 
(Created page with "Category:gene == Gene SJ20648 == * transcription-direction: ** positive * right-end-position: ** 556550 * left-end-position: ** 521597 * centisome-position: ** 84.59738...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-OXALOACETATE ENOL-OXALOACETATE] ==
+
== Gene SJ20648 ==
−
* common-name:
+
* transcription-direction:
−
** enol-oxaloacetate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c([o-])(=o)c(o)=cc(=o)[o-]
+
** 556550
−
* inchi-key:
+
* left-end-position:
−
** uwyvpfmhmjibhe-uphrsurjsa-l
+
** 521597
−
* molecular-weight:
+
* centisome-position:
−
** 130.057
+
** 84.59738   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[OXALOACETATE-TAUTOMERASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
−
{{#set: common-name=enol-oxaloacetate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=uwyvpfmhmjibhe-uphrsurjsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=130.057}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=556550}}
 +
{{#set: left-end-position=521597}}
 +
{{#set: centisome-position=84.59738    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ20648

  • transcription-direction:
    • positive
  • right-end-position:
    • 556550
  • left-end-position:
    • 521597
  • centisome-position:
    • 84.59738

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ20648&oldid=132760"