Difference between revisions of "SJ20648"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7247 CPD-7247] == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] == * common-name: ** an unwound rna == Reaction(s) known to consume th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7247 CPD-7247] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] ==
 
* common-name:
 
* common-name:
** all-trans-13,14-dihydroretinol
+
** an unwound rna
* smiles:
 
** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
 
* inchi-key:
 
** ovboqvaiymsudt-hrygcdposa-n
 
* molecular-weight:
 
** 288.472
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.99.23-RXN]]
+
* [[RXN-11109]]
* [[RETINOLSAT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-13,14-dihydroretinol}}
+
{{#set: common-name=an unwound rna}}
{{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}}
 
{{#set: molecular-weight=288.472}}
 

Revision as of 09:24, 27 August 2019

Metabolite Unwound-RNA

  • common-name:
    • an unwound rna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality