Difference between revisions of "SJ20677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(...")
(Created page with "Category:gene == Gene SJ20677 == * transcription-direction: ** negative * right-end-position: ** 68613 * left-end-position: ** 36731 * centisome-position: ** 17.935759...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] ==
+
== Gene SJ20677 ==
* common-name:
+
* transcription-direction:
** 5'-deoxyadenosine
+
** negative
* smiles:
+
* right-end-position:
** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
+
** 68613
* inchi-key:
+
* left-end-position:
** xgyimtfotbmpfp-kqynxxcusa-n
+
** 36731
* molecular-weight:
+
* centisome-position:
** 251.244
+
** 17.935759   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[2.8.1.6-RXN]]
+
== Reaction(s) associated ==
* [[HEMN-RXN]]
+
* [[3.4.19.12-RXN]]
* [[PYRIMSYN1-RXN]]
+
** Category: [[annotation]]
* [[RXN-11319]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-11586]]
+
{{#set: transcription-direction=negative}}
* [[RXN-14480]]
+
{{#set: right-end-position=68613}}
* [[RXN-14950]]
+
{{#set: left-end-position=36731}}
* [[RXN-14957]]
+
{{#set: centisome-position=17.935759    }}
* [[RXN-14959]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-17472]]
+
{{#set: nb reaction associated=1}}
* [[RXN-17473]]
 
* [[RXN-8340]]
 
* [[RXN0-5063]]
 
* [[RXN0-949]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=5'-deoxyadenosine}}
 
{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
 
{{#set: molecular-weight=251.244}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ20677

  • transcription-direction:
    • negative
  • right-end-position:
    • 68613
  • left-end-position:
    • 36731
  • centisome-position:
    • 17.935759

Organism(s) associated with this gene

Reaction(s) associated