Difference between revisions of "SJ20677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(...")
(Created page with "Category:gene == Gene SJ20515 == * transcription-direction: ** positive * right-end-position: ** 180303 * left-end-position: ** 144813 * centisome-position: ** 69.9009...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] ==
+
== Gene SJ20515 ==
* common-name:
+
* transcription-direction:
** 5'-deoxyadenosine
+
** positive
* smiles:
+
* right-end-position:
** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
+
** 180303
* inchi-key:
+
* left-end-position:
** xgyimtfotbmpfp-kqynxxcusa-n
+
** 144813
* molecular-weight:
+
* centisome-position:
** 251.244
+
** 69.9009   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[2.8.1.6-RXN]]
+
== Reaction(s) associated ==
* [[HEMN-RXN]]
+
* [[2.7.10.1-RXN]]
* [[PYRIMSYN1-RXN]]
+
** Category: [[orthology]]
* [[RXN-11319]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-11586]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-14480]]
+
** Category: [[annotation]]
* [[RXN-14950]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14957]]
+
* [[RXN-8443]]
* [[RXN-14959]]
+
** Category: [[orthology]]
* [[RXN-17472]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[RXN-17473]]
+
== Pathway(s) associated ==
* [[RXN-8340]]
+
* [[PWY-5381]]
* [[RXN0-5063]]
+
** '''6''' reactions found over '''11''' reactions in the full pathway
* [[RXN0-949]]
+
{{#set: transcription-direction=positive}}
== Reaction(s) of unknown directionality ==
+
{{#set: right-end-position=180303}}
{{#set: common-name=5'-deoxyadenosine}}
+
{{#set: left-end-position=144813}}
{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
+
{{#set: centisome-position=69.9009    }}
{{#set: molecular-weight=251.244}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ20515

  • transcription-direction:
    • positive
  • right-end-position:
    • 180303
  • left-end-position:
    • 144813
  • centisome-position:
    • 69.9009

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway