Difference between revisions of "SJ20680"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] ==
 * common-name:
-** (2s)-eriodictyol
+** phytyl diphosphate
 * smiles:
-** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o)
+** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 * inchi-key:
-** sbhxytngizcorc-zdusscgksa-m
+** itplbnccpzsweu-pyddkjgssa-k
 * molecular-weight:
-** 287.248
+** 453.471
 == Reaction(s) known to consume the compound ==
-* [[RXN-7775]]
+* [[RXN-2541]]
+* [[RXN-7660]]
+* [[RXN-7674]]
+* [[RXN1F-66]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-10625]]
+* [[RXN-7660]]
+* [[RXN1F-66]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2s)-eriodictyol}}
+{{#set: common-name=phytyl diphosphate}}
-{{#set: inchi-key=inchikey=sbhxytngizcorc-zdusscgksa-m}}
+{{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}}
-{{#set: molecular-weight=287.248}}
+{{#set: molecular-weight=453.471}}