Difference between revisions of "SJ20683"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCYL-PEPTIDE == * smiles: ** c(c(nc(c(o)=o)[r])=o)n * common-name: ** glycyl-peptide == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3766 == |
| + | * common-name: | ||
| + | ** menadione | ||
* smiles: | * smiles: | ||
| − | ** | + | ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** mjvavzpdrwsrrc-uhfffaoysa-n |
| + | * molecular-weight: | ||
| + | ** 172.183 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menadione}} |
| + | {{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=172.183}} | ||
Revision as of 11:12, 15 January 2021
Contents
Metabolite CPD-3766
- common-name:
- menadione
- smiles:
- cc2(=cc(c1(c=cc=cc=1c2=o))=o)
- inchi-key:
- mjvavzpdrwsrrc-uhfffaoysa-n
- molecular-weight:
- 172.183
