Difference between revisions of "SJ20683"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
(Created page with "Category:gene == Gene SJ16259 == * transcription-direction: ** negative * right-end-position: ** 689187 * left-end-position: ** 681130 * centisome-position: ** 98.76602...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ16259 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** negative |
| − | * | + | * right-end-position: |
| − | ** | + | ** 689187 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 681130 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 98.76602 |
| − | == | + | == Organism(s) associated with this gene == |
| − | * [[ | + | * [[S.japonica_carotenoid_curated]] |
| − | == Reaction(s) | + | == Reaction(s) associated == |
| − | == | + | * [[1.14.13.8-RXN]] |
| − | {{#set: | + | ** Category: [[annotation]] |
| − | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | {{#set: | + | * [[RXN66-81]] |
| + | ** Category: [[annotation]] | ||
| + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
| + | * [[RXNDQC-2]] | ||
| + | ** Category: [[annotation]] | ||
| + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
| + | == Pathway(s) associated == | ||
| + | * [[PWY66-201]] | ||
| + | ** '''3''' reactions found over '''16''' reactions in the full pathway | ||
| + | * [[PWYDQC-4]] | ||
| + | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
| + | * [[PWY-581]] | ||
| + | ** '''5''' reactions found over '''12''' reactions in the full pathway | ||
| + | {{#set: transcription-direction=negative}} | ||
| + | {{#set: right-end-position=689187}} | ||
| + | {{#set: left-end-position=681130}} | ||
| + | {{#set: centisome-position=98.76602 }} | ||
| + | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
| + | {{#set: nb reaction associated=3}} | ||
| + | {{#set: nb pathway associated=3}} | ||
Revision as of 08:23, 15 March 2021
Contents
Gene SJ16259
- transcription-direction:
- negative
- right-end-position:
- 689187
- left-end-position:
- 681130
- centisome-position:
- 98.76602
Organism(s) associated with this gene
Reaction(s) associated
- 1.14.13.8-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN66-81
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXNDQC-2
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY66-201
- 3 reactions found over 16 reactions in the full pathway
- PWYDQC-4
- 1 reactions found over 2 reactions in the full pathway
- PWY-581
- 5 reactions found over 12 reactions in the full pathway
