Difference between revisions of "SJ20683"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
(Created page with "Category:metabolite == Metabolite GLYCYL-PEPTIDE == * smiles: ** c(c(nc(c(o)=o)[r])=o)n * common-name: ** glycyl-peptide == Reaction(s) known to consume the compound == *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLYCYL-PEPTIDE == |
+ | * smiles: | ||
+ | ** c(c(nc(c(o)=o)[r])=o)n | ||
* common-name: | * common-name: | ||
− | ** | + | ** glycyl-peptide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.3.1.97-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glycyl-peptide}} |
− | |||
− |
Revision as of 18:52, 14 January 2021
Contents
Metabolite GLYCYL-PEPTIDE
- smiles:
- c(c(nc(c(o)=o)[r])=o)n
- common-name:
- glycyl-peptide