Difference between revisions of "SJ20690"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-DNA-hybrids RNA-DNA-hybrids] == * common-name: ** a rna-dna hybrid == Reaction(s) known to...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * common-name: ** indoxyl sulfate * smiles: ** c2(c=cc1(=c(c(os([o-])(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-DNA-hybrids RNA-DNA-hybrids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
 
* common-name:
 
* common-name:
** a rna-dna hybrid
+
** indoxyl sulfate
 +
* smiles:
 +
** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2))
 +
* inchi-key:
 +
** bxffhsidqofmle-uhfffaoysa-m
 +
* molecular-weight:
 +
** 212.2
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.26.4-RXN]]
+
* [[RXN-15587]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15587]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a rna-dna hybrid}}
+
{{#set: common-name=indoxyl sulfate}}
 +
{{#set: inchi-key=inchikey=bxffhsidqofmle-uhfffaoysa-m}}
 +
{{#set: molecular-weight=212.2}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-16817

  • common-name:
    • indoxyl sulfate
  • smiles:
    • c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2))
  • inchi-key:
    • bxffhsidqofmle-uhfffaoysa-m
  • molecular-weight:
    • 212.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality