Difference between revisions of "SJ20707"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_III COPROPORPHYRINOGEN_III] == * common-name: ** coproporphyrinogen iii * sm...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] == * common-name: ** a 3-oxo-g...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_III COPROPORPHYRINOGEN_III] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] ==
 
* common-name:
 
* common-name:
** coproporphyrinogen iii
+
** a 3-oxo-glutaryl-[acp] methyl ester
* smiles:
 
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
* inchi-key:
 
** niuvhxtxuxofeb-uhfffaoysa-j
 
* molecular-weight:
 
** 656.734
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEMN-RXN]]
+
* [[RXN-11476]]
* [[RXN-17517]]
 
* [[RXN0-1461]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROGENDECARBOX-RXN]]
+
* [[RXN-11474]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen iii}}
+
{{#set: common-name=a 3-oxo-glutaryl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
 
{{#set: molecular-weight=656.734}}
 

Revision as of 09:24, 27 August 2019

Metabolite 3-Ketoglutaryl-ACP-methyl-ester

  • common-name:
    • a 3-oxo-glutaryl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-glutaryl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.