Difference between revisions of "SJ20730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=yW-86 yW-86] == * common-name: ** 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnap...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=yW-86 yW-86] ==
 
* common-name:
 
* common-name:
** 2-trans, 4-trans-undecadienoyl-coa
+
** 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe
* smiles:
 
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** szkpluulggerfd-msnzeopqsa-j
 
* molecular-weight:
 
** 927.749
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14790]]
 
* [[RXN-14791]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14789]]
+
* [[RXN-14518]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
+
{{#set: common-name=7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
 
{{#set: molecular-weight=927.749}}
 

Revision as of 14:19, 26 August 2019

Metabolite yW-86

  • common-name:
    • 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.