Difference between revisions of "SJ20730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=...")
(Created page with "Category:gene == Gene SJ20730 == * transcription-direction: ** negative * right-end-position: ** 163165 * left-end-position: ** 141245 * centisome-position: ** 69.20688...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] ==
+
== Gene SJ20730 ==
* common-name:
+
* transcription-direction:
** pinocembrin chalcone
+
** negative
* smiles:
+
* right-end-position:
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
+
** 163165
* inchi-key:
+
* left-end-position:
** loyxtwzxlwhmbx-votsokgwsa-n
+
** 141245
* molecular-weight:
+
* centisome-position:
** 256.257
+
** 69.20688   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-7647]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-7645]]
+
* [[RXN-14177]]
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=pinocembrin chalcone}}
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=256.257}}
+
* [[RXN-15843]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=163165}}
 +
{{#set: left-end-position=141245}}
 +
{{#set: centisome-position=69.20688    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ20730

  • transcription-direction:
    • negative
  • right-end-position:
    • 163165
  • left-end-position:
    • 141245
  • centisome-position:
    • 69.20688

Organism(s) associated with this gene

Reaction(s) associated