Difference between revisions of "SJ20736"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o...")
(Created page with "Category:gene == Gene SJ15828 == * transcription-direction: ** negative * right-end-position: ** 132454 * left-end-position: ** 124362 * centisome-position: ** 17.916782...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] ==
+
== Gene SJ15828 ==
* common-name:
+
* transcription-direction:
** 3-ethylmalate
+
** negative
* smiles:
+
* right-end-position:
** ccc(c([o-])=o)c(c(=o)[o-])o
+
** 132454
* inchi-key:
+
* left-end-position:
** jucrenbzzqkfgk-uhfffaoysa-l
+
** 124362
* molecular-weight:
+
* centisome-position:
** 160.126
+
** 17.916782   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-14986]]
+
* [[S.japonica_sterols_curated]]
* [[RXN-18210]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-15561]]
* [[RXN-18210]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=3-ethylmalate}}
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
{{#set: inchi-key=inchikey=jucrenbzzqkfgk-uhfffaoysa-l}}
+
** Category: [[annotation]]
{{#set: molecular-weight=160.126}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=132454}}
 +
{{#set: left-end-position=124362}}
 +
{{#set: centisome-position=17.916782    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ15828

  • transcription-direction:
    • negative
  • right-end-position:
    • 132454
  • left-end-position:
    • 124362
  • centisome-position:
    • 17.916782

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway