Difference between revisions of "SJ20745"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-containing-5-taurinomethyluridine tRNA-containing-5-taurinomethyluridine] == * common-name...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] == * common-name: ** pyridoxal 5'-phosphate * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxal 5'-phosphate |
| + | * smiles: | ||
| + | ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) | ||
| + | * inchi-key: | ||
| + | ** ngvdgcnfywlifo-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 245.128 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.3.74-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PMPOXI-RXN]] | ||
| + | * [[PNPOXI-RXN]] | ||
| + | * [[PYRIDOXKIN-RXN]] | ||
| + | * [[RXN-11322]] | ||
| + | * [[RXN-12590]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxal 5'-phosphate}} |
| + | {{#set: inchi-key=inchikey=ngvdgcnfywlifo-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=245.128}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite PYRIDOXAL_PHOSPHATE
- common-name:
- pyridoxal 5'-phosphate
- smiles:
- cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-])
- inchi-key:
- ngvdgcnfywlifo-uhfffaoysa-l
- molecular-weight:
- 245.128
