Difference between revisions of "SJ20745"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL_PHOSPHATE PYRIDOXAL_PHOSPHATE] == * common-name: ** pyridoxal 5'-phosphate * smiles:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10420 CPD-10420] == * common-name: ** 4-sulfomuconolactone * smiles: ** c([o-])(=o)cc1(s(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10420 CPD-10420] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-sulfomuconolactone |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** weeoykxhmipyqx-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.153 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9733]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-sulfomuconolactone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=weeoykxhmipyqx-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.153}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-10420
- common-name:
- 4-sulfomuconolactone
- smiles:
- c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1)
- inchi-key:
- weeoykxhmipyqx-uhfffaoysa-l
- molecular-weight:
- 220.153
