Difference between revisions of "SJ20745"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10420 CPD-10420] == * common-name: ** 4-sulfomuconolactone * smiles: ** c([o-])(=o)cc1(s(=o...")
(Created page with "Category:gene == Gene SJ00027 == * transcription-direction: ** negative * right-end-position: ** 448186 * left-end-position: ** 429728 * centisome-position: ** 29.252...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10420 CPD-10420] ==
+
== Gene SJ00027 ==
* common-name:
+
* transcription-direction:
** 4-sulfomuconolactone
+
** negative
* smiles:
+
* right-end-position:
** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1)
+
** 448186
* inchi-key:
+
* left-end-position:
** weeoykxhmipyqx-uhfffaoysa-l
+
** 429728
* molecular-weight:
+
* centisome-position:
** 220.153
+
** 29.252   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-9733]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
{{#set: common-name=4-sulfomuconolactone}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=weeoykxhmipyqx-uhfffaoysa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=220.153}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7850]]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=448186}}
 +
{{#set: left-end-position=429728}}
 +
{{#set: centisome-position=29.252    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ00027

  • transcription-direction:
    • negative
  • right-end-position:
    • 448186
  • left-end-position:
    • 429728
  • centisome-position:
    • 29.252

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7850
    • 1 reactions found over 4 reactions in the full pathway