Difference between revisions of "SJ20755"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * common-name: ** betanidin * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
 
* common-name:
 
* common-name:
** betanidin
+
** 6-cis-tridecenoyl-coa
 
* smiles:
 
* smiles:
** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
+
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** xhjkhsxhwjcblx-aaeuagobsa-l
+
** uuivzebypbpkll-dxazuofzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 386.317
+
** 957.819
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8635]]
+
* [[RXN-14771]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=betanidin}}
+
{{#set: common-name=6-cis-tridecenoyl-coa}}
{{#set: inchi-key=inchikey=xhjkhsxhwjcblx-aaeuagobsa-l}}
+
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
{{#set: molecular-weight=386.317}}
+
{{#set: molecular-weight=957.819}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-15637

  • common-name:
    • 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • uuivzebypbpkll-dxazuofzsa-j
  • molecular-weight:
    • 957.819

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality