Difference between revisions of "SJ20823"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVIN RIBOFLAVIN] == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)...")
(Created page with "Category:gene == Gene SJ20823 == * transcription-direction: ** positive * right-end-position: ** 45114 * left-end-position: ** 39823 * centisome-position: ** 19.627296...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVIN RIBOFLAVIN] ==
+
== Gene SJ20823 ==
* common-name:
+
* transcription-direction:
** riboflavin
+
** positive
* smiles:
+
* right-end-position:
** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
+
** 45114
* inchi-key:
+
* left-end-position:
** aunganrzjhbgpy-scrdcrapsa-m
+
** 39823
* molecular-weight:
+
* centisome-position:
** 375.36
+
** 19.627296   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ARPT]]
+
* [[S.japonica_carotenoid_curated]]
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+
== Reaction(s) associated ==
* [[RIBOFLAVINKIN-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-12445]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RIBOFLAVIN-SYN-RXN]]
+
* [[RXN-8443]]
* [[RXN0-5187]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=riboflavin}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}}
+
* [[PWY-5381]]
{{#set: molecular-weight=375.36}}
+
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=45114}}
 +
{{#set: left-end-position=39823}}
 +
{{#set: centisome-position=19.627296    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ20823

  • transcription-direction:
    • positive
  • right-end-position:
    • 45114
  • left-end-position:
    • 39823
  • centisome-position:
    • 19.627296

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway