Difference between revisions of "SJ20823"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVIN RIBOFLAVIN] == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == |
* common-name: | * common-name: | ||
| − | ** | + | ** baicalein |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fxnfhkrtjbstcs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 270.241 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-14240]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=baicalein}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fxnfhkrtjbstcs-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=270.241}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-12724
- common-name:
- baicalein
- smiles:
- c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
- inchi-key:
- fxnfhkrtjbstcs-uhfffaoysa-n
- molecular-weight:
- 270.241
