Difference between revisions of "SJ20829"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...")
(Created page with "Category:gene == Gene SJ20829 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
+
== Gene SJ20829 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** malonyl-coa
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[4.2.2.10-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** ltyoqgrjfjakna-dvvlenmvsa-i
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-14897]]
** 848.541
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Pathway(s) associated ==
* [[ACOACXr]]
+
* [[PWY-7243]]
* [[FATTY-ACID-SYNTHASE-RXN]]
+
** '''1''' reactions found over '''n.a''' reactions in the full pathway
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
{{#set: nb reaction associated=2}}
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
{{#set: nb pathway associated=1}}
* [[RXN-10059]]
 
* [[RXN-10734]]
 
* [[RXN-12777]]
 
* [[RXN-13294]]
 
* [[RXN-13295]]
 
* [[RXN-13296]]
 
* [[RXN-13297]]
 
* [[RXN-13322]]
 
* [[RXN-13431]]
 
* [[RXN-13441]]
 
* [[RXN-14492]]
 
* [[RXN-16016]]
 
* [[RXN-16017]]
 
* [[RXN-16094]]
 
* [[RXN-16153]]
 
* [[RXN-3142]]
 
* [[RXN-7645]]
 
* [[RXN-7697]]
 
* [[RXN-9543]]
 
* [[RXN-9632]]
 
* [[RXN-9648]]
 
* [[RXN-9650]]
 
* [[RXN-9651]]
 
* [[RXN-9652]]
 
* [[RXN-9653]]
 
* [[RXN-9654]]
 
* [[RXN1G-368]]
 
* [[RXN1G-445]]
 
* [[RXN1G-499]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
* [[RXN0-5055]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=malonyl-coa}}
 
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
 
{{#set: molecular-weight=848.541}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ20829

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7243
    • 1 reactions found over n.a reactions in the full pathway