Difference between revisions of "SJ20829"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIETHYLPHOSPHATE DIETHYLPHOSPHATE] == * common-name: ** diethylphosphate * smiles: ** ccop(=o)(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == |
* common-name: | * common-name: | ||
− | ** | + | ** malonyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ltyoqgrjfjakna-dvvlenmvsa-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 848.541 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> | ||
+ | * [[ACOACXr]] | ||
+ | * [[FATTY-ACID-SYNTHASE-RXN]] | ||
+ | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] | ||
+ | * [[MALONYL-COA-DECARBOXYLASE-RXN]] | ||
+ | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | ||
+ | * [[RXN-10059]] | ||
+ | * [[RXN-10734]] | ||
+ | * [[RXN-12777]] | ||
+ | * [[RXN-13294]] | ||
+ | * [[RXN-13295]] | ||
+ | * [[RXN-13296]] | ||
+ | * [[RXN-13297]] | ||
+ | * [[RXN-13322]] | ||
+ | * [[RXN-13431]] | ||
+ | * [[RXN-13441]] | ||
+ | * [[RXN-14492]] | ||
+ | * [[RXN-16016]] | ||
+ | * [[RXN-16017]] | ||
+ | * [[RXN-16094]] | ||
+ | * [[RXN-16153]] | ||
+ | * [[RXN-3142]] | ||
+ | * [[RXN-7645]] | ||
+ | * [[RXN-7697]] | ||
+ | * [[RXN-9543]] | ||
+ | * [[RXN-9632]] | ||
+ | * [[RXN-9648]] | ||
+ | * [[RXN-9650]] | ||
+ | * [[RXN-9651]] | ||
+ | * [[RXN-9652]] | ||
+ | * [[RXN-9653]] | ||
+ | * [[RXN-9654]] | ||
+ | * [[RXN1G-368]] | ||
+ | * [[RXN1G-445]] | ||
+ | * [[RXN1G-499]] | ||
+ | </div> | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
+ | * [[RXN0-5055]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=malonyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=848.541}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite MALONYL-COA
- common-name:
- malonyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ltyoqgrjfjakna-dvvlenmvsa-i
- molecular-weight:
- 848.541
Reaction(s) known to consume the compound
- ACOACXr
- FATTY-ACID-SYNTHASE-RXN
- MALONYL-COA-ACP-TRANSACYL-RXN
- MALONYL-COA-DECARBOXYLASE-RXN
- NARINGENIN-CHALCONE-SYNTHASE-RXN
- RXN-10059
- RXN-10734
- RXN-12777
- RXN-13294
- RXN-13295
- RXN-13296
- RXN-13297
- RXN-13322
- RXN-13431
- RXN-13441
- RXN-14492
- RXN-16016
- RXN-16017
- RXN-16094
- RXN-16153
- RXN-3142
- RXN-7645
- RXN-7697
- RXN-9543
- RXN-9632
- RXN-9648
- RXN-9650
- RXN-9651
- RXN-9652
- RXN-9653
- RXN-9654
- RXN1G-368
- RXN1G-445
- RXN1G-499