Difference between revisions of "SJ20829"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...")
(Created page with "Category:gene == Gene SJ05312 == * transcription-direction: ** positive * right-end-position: ** 21842 * left-end-position: ** 11567 * centisome-position: ** 12.282974...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
+
== Gene SJ05312 ==
−
* common-name:
+
* transcription-direction:
−
** malonyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 21842
−
* inchi-key:
+
* left-end-position:
−
** ltyoqgrjfjakna-dvvlenmvsa-i
+
** 11567
−
* molecular-weight:
+
* centisome-position:
−
** 848.541
+
** 12.282974   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
 +
* [[S.japonica_sterols_curated]]
 +
== Reaction(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[ACOACXr]]
+
* [[ATPASE-RXN]]
−
* [[FATTY-ACID-SYNTHASE-RXN]]
+
** Category: [[annotation]]
−
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
** Category: [[orthology]]
−
* [[RXN-10059]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-10734]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-12777]]
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
−
* [[RXN-13294]]
+
** Category: [[orthology]]
−
* [[RXN-13295]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-13296]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-13297]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
−
* [[RXN-13322]]
+
** Category: [[annotation]]
−
* [[RXN-13431]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-13441]]
+
* [[RXN-11109]]
−
* [[RXN-14492]]
+
** Category: [[annotation]]
−
* [[RXN-16016]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-16017]]
+
* [[RXN-12195]]
−
* [[RXN-16094]]
+
** Category: [[annotation]]
−
* [[RXN-16153]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-3142]]
+
* [[RXN-12196]]
−
* [[RXN-7645]]
+
** Category: [[annotation]]
−
* [[RXN-7697]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-9543]]
+
* [[RXN0-5462]]
−
* [[RXN-9632]]
+
** Category: [[annotation]]
−
* [[RXN-9648]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-9650]]
 
−
* [[RXN-9651]]
 
−
* [[RXN-9652]]
 
−
* [[RXN-9653]]
 
−
* [[RXN-9654]]
 
−
* [[RXN1G-368]]
 
−
* [[RXN1G-445]]
 
−
* [[RXN1G-499]]
 
 
</div>
 
</div>
−
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* [[PWY-6797]]
−
* [[RXN0-5055]]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-6147]]
−
{{#set: common-name=malonyl-coa}}
+
** '''5''' reactions found over '''5''' reactions in the full pathway
−
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
+
* [[PWY-7539]]
−
{{#set: molecular-weight=848.541}}
+
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6545]]
 +
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7210]]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-7198]]
 +
** '''6''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7184]]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=21842}}
 +
{{#set: left-end-position=11567}}
 +
{{#set: centisome-position=12.282974    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=8}}
 +
{{#set: nb pathway associated=7}}

Revision as of 20:20, 18 December 2020

Gene SJ05312

  • transcription-direction:
    • positive
  • right-end-position:
    • 21842
  • left-end-position:
    • 11567
  • centisome-position:
    • 12.282974

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6797
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-6147
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-7539
    • 4 reactions found over 5 reactions in the full pathway
  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ20829&oldid=40960"