Difference between revisions of "SJ20831"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-en...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FA Odd-Straight-Chain-234-Sat-FA] == * common-name: ** an odd number...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FA Odd-Straight-Chain-234-Sat-FA] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-enoyl)-coa
+
** an odd numbered straight chain 2,3,4-saturated fatty acid
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
 
* inchi-key:
 
** qsaqfdywynlxec-guqxggmcsa-j
 
* molecular-weight:
 
** 981.797
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10705]]
+
* [[RXN66-477]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10707]]
+
* [[RXN66-476]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-enoyl)-coa}}
+
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acid}}
{{#set: inchi-key=inchikey=qsaqfdywynlxec-guqxggmcsa-j}}
 
{{#set: molecular-weight=981.797}}
 

Revision as of 09:25, 27 August 2019

Metabolite Odd-Straight-Chain-234-Sat-FA

  • common-name:
    • an odd numbered straight chain 2,3,4-saturated fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality