Difference between revisions of "SJ20859"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-941 CPD-941] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] ==
 * common-name:
-** s-(2-methylbutanoyl)-dihydrolipoamide
+** l-phenylalanine
 * smiles:
-** ccc(c(sccc(ccccc(n)=o)s)=o)c
+** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
 * inchi-key:
-** ufncwfssegpjnl-uhfffaoysa-n
+** colnvldhvkwlrt-qmmmgpobsa-n
 * molecular-weight:
-** 291.466
+** 165.191
 == Reaction(s) known to consume the compound ==
-* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
+* [[2.6.1.64-RXN]]
+* [[PHEAMINOTRANS-RXN]]
+* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
+* [[RXN-10814]]
+* [[RXN-17130]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
+* [[2.6.1.64-RXN]]
+* [[PHEAMINOTRANS-RXN]]
+* [[RXN-10814]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}}
+{{#set: common-name=l-phenylalanine}}
-{{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
-{{#set: molecular-weight=291.466}}
+{{#set: molecular-weight=165.191}}