Difference between revisions of "SJ20867"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glycosylated-sugar-Acceptors Non-Glycosylated-sugar-Acceptors] == * common-name: ** a non g...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] == * common-name: ** dtdp-4-dehydro-6-deoxy-&a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glycosylated-sugar-Acceptors Non-Glycosylated-sugar-Acceptors] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] ==
 
* common-name:
 
* common-name:
** a non glycosylated sugar acceptor
+
** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 +
* inchi-key:
 +
** psxwnitxwwecny-ucbtuhgzsa-l
 +
* molecular-weight:
 +
** 544.302
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DTDPDEHYDRHAMEPIM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.24-RXN]]
+
* [[DTDPGLUCDEHYDRAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a non glycosylated sugar acceptor}}
+
{{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}}
 +
{{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}}
 +
{{#set: molecular-weight=544.302}}

Revision as of 09:23, 27 August 2019

Metabolite DTDP-DEOH-DEOXY-GLUCOSE

  • common-name:
    • dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
  • inchi-key:
    • psxwnitxwwecny-ucbtuhgzsa-l
  • molecular-weight:
    • 544.302

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality