Difference between revisions of "SJ20921"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([...")
 
(Created page with "Category:gene == Gene SJ20921 == * transcription-direction: ** positive * right-end-position: ** 130823 * left-end-position: ** 123348 * centisome-position: ** 61.039497...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] ==
+
== Gene SJ20921 ==
* common-name:
+
* transcription-direction:
** dimethylallyl diphosphate
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** 130823
* inchi-key:
+
* left-end-position:
** cbidrcwhncksto-uhfffaoysa-k
+
** 123348
* molecular-weight:
+
* centisome-position:
** 243.069
+
** 61.039497   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[GPPS]]
+
* [[S.japonica_carotenoid_curated]]
* [[GPPSYN-RXN]]
+
== Reaction(s) associated ==
* [[IPPISOM-RXN]]
+
* [[2.7.11.14-RXN]]
* [[RXN-4303]]
+
** Category: [[annotation]]
* [[RXN-4305]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-4307]]
+
* [[2.7.11.15-RXN]]
* [[RXN-7810]]
+
** Category: [[annotation]]
* [[RXN-7811]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-7813]]
+
* [[2.7.11.16-RXN]]
* [[RXN0-6274]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GPPSYN-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[IDI]]
+
** Category: [[annotation]]
* [[IDS2]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[IPPISOM-RXN]]
+
** Category: [[orthology]]
* [[RXN0-884]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=positive}}
{{#set: common-name=dimethylallyl diphosphate}}
+
{{#set: right-end-position=130823}}
{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
+
{{#set: left-end-position=123348}}
{{#set: molecular-weight=243.069}}
+
{{#set: centisome-position=61.039497    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:01, 18 March 2021

Gene SJ20921

  • transcription-direction:
    • positive
  • right-end-position:
    • 130823
  • left-end-position:
    • 123348
  • centisome-position:
    • 61.039497

Organism(s) associated with this gene

Reaction(s) associated