Difference between revisions of "SJ20921"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Chain-234-Saturated-acyl-CoAs Short-Chain-234-Saturated-acyl-CoAs] ==
 * common-name:
-** dimethylallyl diphosphate
+** a short-chain 2,3,4-saturated fatty acyl coa
-* smiles:
-** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
-* inchi-key:
-** cbidrcwhncksto-uhfffaoysa-k
-* molecular-weight:
-** 243.069
 == Reaction(s) known to consume the compound ==
-* [[GPPS]]
+* [[RXN-13449]]
-* [[GPPSYN-RXN]]
-* [[IPPISOM-RXN]]
-* [[RXN-4303]]
-* [[RXN-4305]]
-* [[RXN-4307]]
-* [[RXN-7810]]
-* [[RXN-7811]]
-* [[RXN-7813]]
-* [[RXN0-6274]]
 == Reaction(s) known to produce the compound ==
-* [[GPPSYN-RXN]]
-* [[IDI]]
-* [[IDS2]]
-* [[IPPISOM-RXN]]
-* [[RXN0-884]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dimethylallyl diphosphate}}
+{{#set: common-name=a short-chain 2,3,4-saturated fatty acyl coa}}
-{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
-{{#set: molecular-weight=243.069}}