Difference between revisions of "SJ20964"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] == * common-name: ** an oxidized flavodoxin == React...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] ==
 
* common-name:
 
* common-name:
** an oxidized flavodoxin
+
** pinocembrin chalcone
 +
* smiles:
 +
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
 +
* inchi-key:
 +
** loyxtwzxlwhmbx-votsokgwsa-n
 +
* molecular-weight:
 +
** 256.257
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FLAVONADPREDUCT-RXN]]
+
* [[RXN-7647]]
* [[PYFLAVOXRE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FLAVONADPREDUCT-RXN]]
+
* [[RXN-7645]]
* [[PYFLAVOXRE-RXN]]
 
* [[RXN-15878]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized flavodoxin}}
+
{{#set: common-name=pinocembrin chalcone}}
 +
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
 +
{{#set: molecular-weight=256.257}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-6993

  • common-name:
    • pinocembrin chalcone
  • smiles:
    • c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
  • inchi-key:
    • loyxtwzxlwhmbx-votsokgwsa-n
  • molecular-weight:
    • 256.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality