Difference between revisions of "SJ20972"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY GLY] == * common-name: ** glycine * smiles: ** c([n+])c([o-])=o * inchi-key: ** dhmqdgoqfoq...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PHOSPHONOOXY-THREONINE 4-PHOSPHONOOXY-THREONINE] == * common-name: ** 4-phosphooxy-l-threonin...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PHOSPHONOOXY-THREONINE 4-PHOSPHONOOXY-THREONINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-phosphooxy-l-threonine |
* smiles: | * smiles: | ||
| − | ** c([n+])c([o-])=o | + | ** c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fkhakijokdgeii-gbxijsldsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 213.083 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PSERTRANSAMPYR-RXN]] |
| − | + | * [[RXN-14125]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[PSERTRANSAMPYR-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-phosphooxy-l-threonine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fkhakijokdgeii-gbxijsldsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=213.083}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite 4-PHOSPHONOOXY-THREONINE
- common-name:
- 4-phosphooxy-l-threonine
- smiles:
- c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-]
- inchi-key:
- fkhakijokdgeii-gbxijsldsa-l
- molecular-weight:
- 213.083
