Difference between revisions of "SJ20991"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8462 CPD-8462] == * common-name: ** pentadecanoate * smiles: ** ccccccccccccccc([o-])=o * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8462 CPD-8462] ==
 
* common-name:
 
* common-name:
** sirohydrochlorin
+
** pentadecanoate
 
* smiles:
 
* smiles:
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
+
** ccccccccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
** kwizrxmmfrbuml-ahgfgahvsa-f
+
** wqepluugtldzjy-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 854.779
+
** 241.393
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.99.1.3-RXN]]
 
* [[SIROHEME-FERROCHELAT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHUROPORDEHYDROG-RXN]]
+
* [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sirohydrochlorin}}
+
{{#set: common-name=pentadecanoate}}
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
+
{{#set: inchi-key=inchikey=wqepluugtldzjy-uhfffaoysa-m}}
{{#set: molecular-weight=854.779}}
+
{{#set: molecular-weight=241.393}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-8462

  • common-name:
    • pentadecanoate
  • smiles:
    • ccccccccccccccc([o-])=o
  • inchi-key:
    • wqepluugtldzjy-uhfffaoysa-m
  • molecular-weight:
    • 241.393

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality