Difference between revisions of "SJ20999"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * common-name: ** trans-δ2, cis-δ4-de...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] ==
 
* common-name:
 
* common-name:
** trans-δ2, cis-δ4-decadienoyl-coa
+
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
 
* smiles:
 
* smiles:
** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** fasakylwsrdqoh-imvfqkdnsa-j
+
** wrgktdwhjsbcjr-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 913.722
+
** 218.224
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIENOYLCOAREDUCT-RXN]]
+
* [[RXN-18208]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18208]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}}
+
{{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
{{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}}
+
{{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}}
{{#set: molecular-weight=913.722}}
+
{{#set: molecular-weight=218.224}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-19491

  • common-name:
    • 3-isopropyl-6-(methylthio)-2-oxohexanoate
  • smiles:
    • c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
  • inchi-key:
    • wrgktdwhjsbcjr-uhfffaoysa-l
  • molecular-weight:
    • 218.224

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality