Difference between revisions of "SJ21008"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c...")
(Created page with "Category:gene == Gene SJ21008 == * transcription-direction: ** positive * right-end-position: ** 60459 * left-end-position: ** 52735 * centisome-position: ** 26.204119...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] ==
+
== Gene SJ21008 ==
* common-name:
+
* transcription-direction:
** β-d-fructose 2,6-bisphosphate
+
** positive
* smiles:
+
* right-end-position:
** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-]
+
** 60459
* inchi-key:
+
* left-end-position:
** yxwoajxnvlxpmu-zxxmmsqzsa-j
+
** 52735
* molecular-weight:
+
* centisome-position:
** 336.085
+
** 26.204119   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3.1.3.46-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
+
* [[LYSINE--TRNA-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=β-d-fructose 2,6-bisphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}}
+
** Category: [[orthology]]
{{#set: molecular-weight=336.085}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=60459}}
 +
{{#set: left-end-position=52735}}
 +
{{#set: centisome-position=26.204119    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ21008

  • transcription-direction:
    • positive
  • right-end-position:
    • 60459
  • left-end-position:
    • 52735
  • centisome-position:
    • 26.204119

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated