Difference between revisions of "SJ21008"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * common-name: ** (6r)-4a-hydroxy-tetrahydrobiopterin * smiles: ** cc(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
 
* common-name:
 
* common-name:
** β-d-fructose 2,6-bisphosphate
+
** (6r)-4a-hydroxy-tetrahydrobiopterin
 
* smiles:
 
* smiles:
** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-]
+
** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2))
 
* inchi-key:
 
* inchi-key:
** yxwoajxnvlxpmu-zxxmmsqzsa-j
+
** kjkiefupappgbc-xxkocqoqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 257.249
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.46-RXN]]
+
* [[RXN-7908]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 2,6-bisphosphate}}
+
{{#set: common-name=(6r)-4a-hydroxy-tetrahydrobiopterin}}
{{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}}
+
{{#set: inchi-key=inchikey=kjkiefupappgbc-xxkocqoqsa-n}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=257.249}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-5881

  • common-name:
    • (6r)-4a-hydroxy-tetrahydrobiopterin
  • smiles:
    • cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2))
  • inchi-key:
    • kjkiefupappgbc-xxkocqoqsa-n
  • molecular-weight:
    • 257.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality