Difference between revisions of "SJ21018"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-DIHYDROFOLATE-GLU-N 10-FORMYL-DIHYDROFOLATE-GLU-N] == * common-name: ** an n10-formyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-DIHYDROFOLATE-GLU-N 10-FORMYL-DIHYDROFOLATE-GLU-N] ==
 
* common-name:
 
* common-name:
** cis-aconitate
+
** an n10-formyldihydrofolate
* smiles:
 
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* molecular-weight:
 
** 171.086
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEDEHYDR-RXN]]
 
* [[ACONITATEHYDR-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[RXN-13908]]
* [[ACONITATEHYDR-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-aconitate}}
+
{{#set: common-name=an n10-formyldihydrofolate}}
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
 
{{#set: molecular-weight=171.086}}
 

Revision as of 14:19, 26 August 2019

Metabolite 10-FORMYL-DIHYDROFOLATE-GLU-N

  • common-name:
    • an n10-formyldihydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality