Difference between revisions of "SJ21062"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] == * common-name: ** s-methyl-5'-thioadenosine * s...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-L-lysine BCCP-L-lysine] == * common-name: ** a [biotin carboxyl-carrier protein]-l-lysine...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-L-lysine BCCP-L-lysine] ==
 
* common-name:
 
* common-name:
** s-methyl-5'-thioadenosine
+
** a [biotin carboxyl-carrier protein]-l-lysine
* smiles:
 
** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 
* inchi-key:
 
** wuugfsxjnotrmr-ioslpcccsa-n
 
* molecular-weight:
 
** 297.331
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[M5TAP]]
+
* [[BIOTINLIG-RXN]]
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
 
* [[RXN-11190]]
 
* [[SPERMIDINESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.4.1.14-RXN]]
 
* [[APAPT]]
 
* [[RXN-11190]]
 
* [[RXN-11371]]
 
* [[RXN-14518]]
 
* [[RXN0-5217]]
 
* [[SPERMIDINESYN-RXN]]
 
* [[SPERMINE-SYNTHASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-methyl-5'-thioadenosine}}
+
{{#set: common-name=a [biotin carboxyl-carrier protein]-l-lysine}}
{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
 
{{#set: molecular-weight=297.331}}
 

Revision as of 09:24, 27 August 2019

Metabolite BCCP-L-lysine

  • common-name:
    • a [biotin carboxyl-carrier protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.